C12H21NO3S2 — CID 54947843
5-ethyl-N-(3-hydroxypropyl)-N-propan-2-ylthiophene-2-sulfonamide (PubChem CID 54947843) has the molecular formula C12H21NO3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-ethyl-N-(3-hydroxypropyl)-N-propan-2-ylthiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-(3-hydroxypropyl)-N-propan-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54947843 |
| Molecular Formula | C12H21NO3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 5-ethyl-N-(3-hydroxypropyl)-N-propan-2-ylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(CCCO)C(C)C)s1 |
| InChI | InChI=1S/C12H21NO3S2/c1-4-11-6-7-12(17-11)18(15,16)13(10(2)3)8-5-9-14/h6-7,10,14H,4-5,8-9H2,1-3H3 |
| InChIKey | DFXAOBIINOOROF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |