C12H17NO6S2 — CID 60952459
2-[5-[(2-methoxy-2-oxoethyl)-propan-2-ylsulfamoyl]thiophen-2-yl]acetic acid (PubChem CID 60952459) has the molecular formula C12H17NO6S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[5-[(2-methoxy-2-oxoethyl)-propan-2-ylsulfamoyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[(2-methoxy-2-oxoethyl)-propan-2-ylsulfamoyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 60952459 |
| Molecular Formula | C12H17NO6S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-[5-[(2-methoxy-2-oxoethyl)-propan-2-ylsulfamoyl]thiophen-2-yl]acetic acid |
| SMILES | COC(=O)CN(C(C)C)S(=O)(=O)c1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C12H17NO6S2/c1-8(2)13(7-11(16)19-3)21(17,18)12-5-4-9(20-12)6-10(14)15/h4-5,8H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | JRWQHUNEKVGUHL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |