C14H25NO2S2 — CID 60530858
5-ethyl-N,N-bis(2-methylpropyl)thiophene-2-sulfonamide (PubChem CID 60530858) has the molecular formula C14H25NO2S2 and a molecular weight of 303.49 g/mol. Its IUPAC name is 5-ethyl-N,N-bis(2-methylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N,N-bis(2-methylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 60530858 |
| Molecular Formula | C14H25NO2S2 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-ethyl-N,N-bis(2-methylpropyl)thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(CC(C)C)CC(C)C)s1 |
| InChI | InChI=1S/C14H25NO2S2/c1-6-13-7-8-14(18-13)19(16,17)15(9-11(2)3)10-12(4)5/h7-8,11-12H,6,9-10H2,1-5H3 |
| InChIKey | UKWSAQYPINWOLD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |