C11H19N3O3S2 — CID 76927493
2-[(5-ethylthiophen-2-yl)sulfonyl-propylamino]-N'-hydroxyethanimidamide (PubChem CID 76927493) has the molecular formula C11H19N3O3S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-[(5-ethylthiophen-2-yl)sulfonyl-propylamino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(5-ethylthiophen-2-yl)sulfonyl-propylamino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 76927493 |
| Molecular Formula | C11H19N3O3S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[(5-ethylthiophen-2-yl)sulfonyl-propylamino]-N'-hydroxyethanimidamide |
| SMILES | CCCN(CC(N)=NO)S(=O)(=O)c1ccc(CC)s1 |
| InChI | InChI=1S/C11H19N3O3S2/c1-3-7-14(8-10(12)13-15)19(16,17)11-6-5-9(4-2)18-11/h5-6,15H,3-4,7-8H2,1-2H3,(H2,12,13) |
| InChIKey | XBQKWTLMIDHRDH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|