C10H16BrN3O3S2 — CID 54996481
3-[(5-bromothiophen-2-yl)sulfonyl-propan-2-ylamino]-N'-hydroxypropanimidamide (PubChem CID 54996481) has the molecular formula C10H16BrN3O3S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 3-[(5-bromothiophen-2-yl)sulfonyl-propan-2-ylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(5-bromothiophen-2-yl)sulfonyl-propan-2-ylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 54996481 |
| Molecular Formula | C10H16BrN3O3S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 3-[(5-bromothiophen-2-yl)sulfonyl-propan-2-ylamino]-N'-hydroxypropanimidamide |
| SMILES | CC(C)N(CC/C(N)=N/O)S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H16BrN3O3S2/c1-7(2)14(6-5-9(12)13-15)19(16,17)10-4-3-8(11)18-10/h3-4,7,15H,5-6H2,1-2H3,(H2,12,13) |
| InChIKey | PQRHJQCSWWSENZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|