C10H19N5O3S — CID 54992419
3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl-ethylamino]-N'-hydroxypropanimidamide (PubChem CID 54992419) has the molecular formula C10H19N5O3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl-ethylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl-ethylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 54992419 |
| Molecular Formula | C10H19N5O3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl-ethylamino]-N'-hydroxypropanimidamide |
| SMILES | CCN(CC/C(N)=N/O)S(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C10H19N5O3S/c1-4-15(6-5-9(11)14-16)19(17,18)10-7(2)12-13-8(10)3/h16H,4-6H2,1-3H3,(H2,11,14)(H,12,13) |
| InChIKey | NYMJRGPHZYDBOM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|