C15H29N3O2S — CID 60700329
3,5-dimethyl-N,N-bis(3-methylbutyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60700329) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is 3,5-dimethyl-N,N-bis(3-methylbutyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N,N-bis(3-methylbutyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60700329 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 3,5-dimethyl-N,N-bis(3-methylbutyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C15H29N3O2S/c1-11(2)7-9-18(10-8-12(3)4)21(19,20)15-13(5)16-17-14(15)6/h11-12H,7-10H2,1-6H3,(H,16,17) |
| InChIKey | JKYBOMLBHGDQRP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |