C10H19N3O3S — CID 115901960
N-(3-hydroxybutyl)-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 115901960) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3-hydroxybutyl)-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115901960 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(3-hydroxybutyl)-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N(C)CCC(C)O |
| InChI | InChI=1S/C10H19N3O3S/c1-7(14)5-6-13(4)17(15,16)10-8(2)11-12-9(10)3/h7,14H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | LYZXXJLUXRNELX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |