C9H16BrN3O2S — CID 80668082
N-(2-bromopropyl)-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 80668082) has the molecular formula C9H16BrN3O2S and a molecular weight of 310.22 g/mol. Its IUPAC name is N-(2-bromopropyl)-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-bromopropyl)-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 80668082 |
| Molecular Formula | C9H16BrN3O2S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | N-(2-bromopropyl)-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N(C)CC(C)Br |
| InChI | InChI=1S/C9H16BrN3O2S/c1-6(10)5-13(4)16(14,15)9-7(2)11-12-8(9)3/h6H,5H2,1-4H3,(H,11,12) |
| InChIKey | RQXFSEGYKIUKEO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|