C14H23N3O3S — CID 80690726
3-[ethyl(2-phenylpropylsulfonyl)amino]-N'-hydroxypropanimidamide (PubChem CID 80690726) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 3-[ethyl(2-phenylpropylsulfonyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[ethyl(2-phenylpropylsulfonyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 80690726 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-[ethyl(2-phenylpropylsulfonyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CCN(CC/C(N)=N/O)S(=O)(=O)CC(C)c1ccccc1 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-17(10-9-14(15)16-18)21(19,20)11-12(2)13-7-5-4-6-8-13/h4-8,12,18H,3,9-11H2,1-2H3,(H2,15,16) |
| InChIKey | BBSRJDKEYDZDIY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|