C13H21N3O3S — CID 77045007
N'-hydroxy-3-[N-(2-methylpropylsulfonyl)anilino]propanimidamide (PubChem CID 77045007) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is N'-hydroxy-3-[N-(2-methylpropylsulfonyl)anilino]propanimidamide.
| Compound Name | N'-hydroxy-3-[N-(2-methylpropylsulfonyl)anilino]propanimidamide |
|---|---|
| PubChem CID | 77045007 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N'-hydroxy-3-[N-(2-methylpropylsulfonyl)anilino]propanimidamide |
| SMILES | CC(C)CS(=O)(=O)N(CCC(N)=NO)c1ccccc1 |
| InChI | InChI=1S/C13H21N3O3S/c1-11(2)10-20(18,19)16(9-8-13(14)15-17)12-6-4-3-5-7-12/h3-7,11,17H,8-10H2,1-2H3,(H2,14,15) |
| InChIKey | YSGTZSAKPIQGKP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|