C13H19Br2NO3S — CID 61061226
2,4-dibromo-N-butan-2-yl-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 61061226) has the molecular formula C13H19Br2NO3S and a molecular weight of 429.17 g/mol. Its IUPAC name is 2,4-dibromo-N-butan-2-yl-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-butan-2-yl-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61061226 |
| Molecular Formula | C13H19Br2NO3S |
| Molecular Weight | 429.17 g/mol |
| Exact Mass | 426.95 |
| IUPAC Name | 2,4-dibromo-N-butan-2-yl-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | CCC(C)N(CCOC)S(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H19Br2NO3S/c1-4-10(2)16(7-8-19-3)20(17,18)13-6-5-11(14)9-12(13)15/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | RGXFKHPRLCKHKW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |