C13H19BrFNO3S — CID 116528510
4-bromo-N-butan-2-yl-2-fluoro-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 116528510) has the molecular formula C13H19BrFNO3S and a molecular weight of 368.27 g/mol. Its IUPAC name is 4-bromo-N-butan-2-yl-2-fluoro-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-butan-2-yl-2-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116528510 |
| Molecular Formula | C13H19BrFNO3S |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 4-bromo-N-butan-2-yl-2-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | CCC(C)N(CCOC)S(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H19BrFNO3S/c1-4-10(2)16(7-8-19-3)20(17,18)13-6-5-11(14)9-12(13)15/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | BJCQXGSBBDDTPJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |