C10H14Br2N2O3S — CID 61127636
2-amino-4,6-dibromo-N-(2-methoxyethyl)-N-methylbenzenesulfonamide (PubChem CID 61127636) has the molecular formula C10H14Br2N2O3S and a molecular weight of 402.11 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-(2-methoxyethyl)-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-(2-methoxyethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61127636 |
| Molecular Formula | C10H14Br2N2O3S |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 399.91 |
| IUPAC Name | 2-amino-4,6-dibromo-N-(2-methoxyethyl)-N-methylbenzenesulfonamide |
| SMILES | COCCN(C)S(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C10H14Br2N2O3S/c1-14(3-4-17-2)18(15,16)10-8(12)5-7(11)6-9(10)13/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | CFCFOOONEYXLNC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|