C13H21Br2N3O2S — CID 102991009
2-amino-4,6-dibromo-N-[3-(dimethylamino)propyl]-N-ethylbenzenesulfonamide (PubChem CID 102991009) has the molecular formula C13H21Br2N3O2S and a molecular weight of 443.21 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-[3-(dimethylamino)propyl]-N-ethylbenzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-[3-(dimethylamino)propyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 102991009 |
| Molecular Formula | C13H21Br2N3O2S |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | 2-amino-4,6-dibromo-N-[3-(dimethylamino)propyl]-N-ethylbenzenesulfonamide |
| SMILES | CCN(CCCN(C)C)S(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C13H21Br2N3O2S/c1-4-18(7-5-6-17(2)3)21(19,20)13-11(15)8-10(14)9-12(13)16/h8-9H,4-7,16H2,1-3H3 |
| InChIKey | SNGWXBDNPAUPGW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|