C12H18Br2N2O3S — CID 107197612
2-amino-4,6-dibromo-N-(5-hydroxypentyl)-N-methylbenzenesulfonamide (PubChem CID 107197612) has the molecular formula C12H18Br2N2O3S and a molecular weight of 430.16 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-(5-hydroxypentyl)-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-(5-hydroxypentyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107197612 |
| Molecular Formula | C12H18Br2N2O3S |
| Molecular Weight | 430.16 g/mol |
| Exact Mass | 427.94 |
| IUPAC Name | 2-amino-4,6-dibromo-N-(5-hydroxypentyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CCCCCO)S(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C12H18Br2N2O3S/c1-16(5-3-2-4-6-17)20(18,19)12-10(14)7-9(13)8-11(12)15/h7-8,17H,2-6,15H2,1H3 |
| InChIKey | IESHBGRDIZJIGE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|