C9H15N3O3S — CID 102691011
N-[2-(2-methylprop-2-enoxy)ethyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102691011) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is N-[2-(2-methylprop-2-enoxy)ethyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[2-(2-methylprop-2-enoxy)ethyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691011 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-[2-(2-methylprop-2-enoxy)ethyl]-1H-pyrazole-5-sulfonamide |
| SMILES | C=C(C)COCCNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H15N3O3S/c1-8(2)7-15-6-5-11-16(13,14)9-3-4-10-12-9/h3-4,11H,1,5-7H2,2H3,(H,10,12) |
| InChIKey | HYJKWYOEUBAAFZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|