C9H16IN3O2S — CID 107849067
N-(6-iodohexyl)-1H-pyrazole-5-sulfonamide (PubChem CID 107849067) has the molecular formula C9H16IN3O2S and a molecular weight of 357.22 g/mol. Its IUPAC name is N-(6-iodohexyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(6-iodohexyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 107849067 |
| Molecular Formula | C9H16IN3O2S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-(6-iodohexyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCCCCCI)c1ccn[nH]1 |
| InChI | InChI=1S/C9H16IN3O2S/c10-6-3-1-2-4-7-12-16(14,15)9-5-8-11-13-9/h5,8,12H,1-4,6-7H2,(H,11,13) |
| InChIKey | ZHXDQKCIGMKQKF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|