C8H12N4O2S — CID 102691141
N-(4-cyanobutyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102691141) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is N-(4-cyanobutyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(4-cyanobutyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691141 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | N-(4-cyanobutyl)-1H-pyrazole-5-sulfonamide |
| SMILES | N#CCCCCNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H12N4O2S/c9-5-2-1-3-6-11-15(13,14)8-4-7-10-12-8/h4,7,11H,1-3,6H2,(H,10,12) |
| InChIKey | KOLAISJKHGIVOU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|