C27H42N6O6S3 — CID 161168550
1-N,2-N,3-N-tris(6-cyanohexyl)benzene-1,2,3-trisulfonamide (PubChem CID 161168550) has the molecular formula C27H42N6O6S3 and a molecular weight of 642.87 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris(6-cyanohexyl)benzene-1,2,3-trisulfonamide.
| Compound Name | 1-N,2-N,3-N-tris(6-cyanohexyl)benzene-1,2,3-trisulfonamide |
|---|---|
| PubChem CID | 161168550 |
| Molecular Formula | C27H42N6O6S3 |
| Molecular Weight | 642.87 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | 1-N,2-N,3-N-tris(6-cyanohexyl)benzene-1,2,3-trisulfonamide |
| SMILES | N#CCCCCCCNS(=O)(=O)c1cccc(S(=O)(=O)NCCCCCCC#N)c1S(=O)(=O)NCCCCCCC#N |
| InChI | InChI=1S/C27H42N6O6S3/c28-19-10-4-1-7-13-22-31-40(34,35)25-17-16-18-26(41(36,37)32-23-14-8-2-5-11-20-29)27(25)42(38,39)33-24-15-9-3-6-12-21-30/h16-18,31-33H,1-15,22-24H2 |
| InChIKey | UQWLMNBWNFLJQT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 209.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|