C21H40N4O4S2 — CID 161288415
N,N'-bis(9-cyanononyl)methanedisulfonamide (PubChem CID 161288415) has the molecular formula C21H40N4O4S2 and a molecular weight of 476.71 g/mol. Its IUPAC name is N,N'-bis(9-cyanononyl)methanedisulfonamide.
| Compound Name | N,N'-bis(9-cyanononyl)methanedisulfonamide |
|---|---|
| PubChem CID | 161288415 |
| Molecular Formula | C21H40N4O4S2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N,N'-bis(9-cyanononyl)methanedisulfonamide |
| SMILES | N#CCCCCCCCCCNS(=O)(=O)CS(=O)(=O)NCCCCCCCCCC#N |
| InChI | InChI=1S/C21H40N4O4S2/c22-17-13-9-5-1-3-7-11-15-19-24-30(26,27)21-31(28,29)25-20-16-12-8-4-2-6-10-14-18-23/h24-25H,1-16,19-21H2 |
| InChIKey | VGAJKRQDZYZLNC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|