C18H30N8O8S4 — CID 159972367
1-N,1-N',1-N",2-N-tetrakis(3-cyanopropyl)ethane-1,1,1,2-tetrasulfonamide (PubChem CID 159972367) has the molecular formula C18H30N8O8S4 and a molecular weight of 614.75 g/mol. Its IUPAC name is 1-N,1-N',1-N",2-N-tetrakis(3-cyanopropyl)ethane-1,1,1,2-tetrasulfonamide.
| Compound Name | 1-N,1-N',1-N",2-N-tetrakis(3-cyanopropyl)ethane-1,1,1,2-tetrasulfonamide |
|---|---|
| PubChem CID | 159972367 |
| Molecular Formula | C18H30N8O8S4 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | 1-N,1-N',1-N",2-N-tetrakis(3-cyanopropyl)ethane-1,1,1,2-tetrasulfonamide |
| SMILES | N#CCCCNS(=O)(=O)CC(S(=O)(=O)NCCCC#N)(S(=O)(=O)NCCCC#N)S(=O)(=O)NCCCC#N |
| InChI | InChI=1S/C18H30N8O8S4/c19-9-1-5-13-23-35(27,28)17-18(36(29,30)24-14-6-2-10-20,37(31,32)25-15-7-3-11-21)38(33,34)26-16-8-4-12-22/h23-26H,1-8,13-17H2 |
| InChIKey | OESFTZVCBJEJKT-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 279.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|