C10H19N3O3S — CID 114168833
N-(3-ethyl-2-hydroxypentyl)-1H-pyrazole-5-sulfonamide (PubChem CID 114168833) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 114168833 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCC(CC)C(O)CNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H19N3O3S/c1-3-8(4-2)9(14)7-12-17(15,16)10-5-6-11-13-10/h5-6,8-9,12,14H,3-4,7H2,1-2H3,(H,11,13) |
| InChIKey | SFWJGPPNGOAWJA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |