C14H20ClN3O3S — CID 120875141
N-[1-(aminomethyl)cyclopentyl]-4-cyano-2-methoxybenzenesulfonamide;hydrochloride (PubChem CID 120875141) has the molecular formula C14H20ClN3O3S and a molecular weight of 345.85 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-4-cyano-2-methoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-4-cyano-2-methoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120875141 |
| Molecular Formula | C14H20ClN3O3S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-4-cyano-2-methoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1cc(C#N)ccc1S(=O)(=O)NC1(CN)CCCC1.Cl |
| InChI | InChI=1S/C14H19N3O3S.ClH/c1-20-12-8-11(9-15)4-5-13(12)21(18,19)17-14(10-16)6-2-3-7-14;/h4-5,8,17H,2-3,6-7,10,16H2,1H3;1H |
| InChIKey | WXYCVVBLXJVUNO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |