C11H18N2O2S2 — CID 120708577
N-(3-aminobutyl)-2-methylsulfanylbenzenesulfonamide (PubChem CID 120708577) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-methylsulfanylbenzenesulfonamide.
| Compound Name | N-(3-aminobutyl)-2-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 120708577 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-(3-aminobutyl)-2-methylsulfanylbenzenesulfonamide |
| SMILES | CSc1ccccc1S(=O)(=O)NCCC(C)N |
| InChI | InChI=1S/C11H18N2O2S2/c1-9(12)7-8-13-17(14,15)11-6-4-3-5-10(11)16-2/h3-6,9,13H,7-8,12H2,1-2H3 |
| InChIKey | CMYNTCHZLCWISX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |