C10H17N3O5S — CID 106843925
N-(4-hydroxybutyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 106843925) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-(4-hydroxybutyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 106843925 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-(4-hydroxybutyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCCCCO)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H17N3O5S/c1-12-7-8(9(15)13(2)10(12)16)19(17,18)11-5-3-4-6-14/h7,11,14H,3-6H2,1-2H3 |
| InChIKey | BPAXQGZPHLLCRV-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|