C9H14N6O4S — CID 61343812
N-(3-azidopropyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 61343812) has the molecular formula C9H14N6O4S and a molecular weight of 302.32 g/mol. Its IUPAC name is N-(3-azidopropyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-(3-azidopropyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 61343812 |
| Molecular Formula | C9H14N6O4S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(3-azidopropyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCCCN=[N+]=[N-])c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H14N6O4S/c1-14-6-7(8(16)15(2)9(14)17)20(18,19)12-5-3-4-11-13-10/h6,12H,3-5H2,1-2H3 |
| InChIKey | OFPOZBUMZCKICU-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|