C11H19N3O5S — CID 107319460
N-(5-hydroxypentyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 107319460) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-(5-hydroxypentyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 107319460 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-(5-hydroxypentyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCCCCCO)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H19N3O5S/c1-13-8-9(10(16)14(2)11(13)17)20(18,19)12-6-4-3-5-7-15/h8,12,15H,3-7H2,1-2H3 |
| InChIKey | ZCZARNYAQFREKX-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|