C13H20ClN3O5S — CID 120717520
N-[2-(2-methoxyethylamino)ethyl]-3-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide;hydrochloride (PubChem CID 120717520) has the molecular formula C13H20ClN3O5S and a molecular weight of 365.84 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-3-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-3-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717520 |
| Molecular Formula | C13H20ClN3O5S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-3-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc2c(c1)oc(=O)n2C.Cl |
| InChI | InChI=1S/C13H19N3O5S.ClH/c1-16-11-4-3-10(9-12(11)21-13(16)17)22(18,19)15-6-5-14-7-8-20-2;/h3-4,9,14-15H,5-8H2,1-2H3;1H |
| InChIKey | QGZKENJWRCWNEA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|