C16H28N4O3S — CID 110627182
4-[4-(2-methoxyethyl)piperazin-1-yl]-N-(propylsulfamoyl)aniline (PubChem CID 110627182) has the molecular formula C16H28N4O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is 4-[4-(2-methoxyethyl)piperazin-1-yl]-N-(propylsulfamoyl)aniline.
| Compound Name | 4-[4-(2-methoxyethyl)piperazin-1-yl]-N-(propylsulfamoyl)aniline |
|---|---|
| PubChem CID | 110627182 |
| Molecular Formula | C16H28N4O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 4-[4-(2-methoxyethyl)piperazin-1-yl]-N-(propylsulfamoyl)aniline |
| SMILES | CCCNS(=O)(=O)Nc1ccc(N2CCN(CCOC)CC2)cc1 |
| InChI | InChI=1S/C16H28N4O3S/c1-3-8-17-24(21,22)18-15-4-6-16(7-5-15)20-11-9-19(10-12-20)13-14-23-2/h4-7,17-18H,3,8-14H2,1-2H3 |
| InChIKey | GJSBKZXJUCPJJD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|