C15H25N3O5S2 — CID 110302048
N-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-2-methoxyethanesulfonamide (PubChem CID 110302048) has the molecular formula C15H25N3O5S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-2-methoxyethanesulfonamide.
| Compound Name | N-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 110302048 |
| Molecular Formula | C15H25N3O5S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-2-methoxyethanesulfonamide |
| SMILES | CCS(=O)(=O)N1CCN(c2ccc(NS(=O)(=O)CCOC)cc2)CC1 |
| InChI | InChI=1S/C15H25N3O5S2/c1-3-25(21,22)18-10-8-17(9-11-18)15-6-4-14(5-7-15)16-24(19,20)13-12-23-2/h4-7,16H,3,8-13H2,1-2H3 |
| InChIKey | ITTLAOQNHBPPMY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|