C16H25N3O4S — CID 47800835
N-(2-methoxyethyl)-2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetamide (PubChem CID 47800835) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetamide |
|---|---|
| PubChem CID | 47800835 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetamide |
| SMILES | COCCNC(=O)CS(=O)(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H25N3O4S/c1-23-12-9-17-16(20)13-24(21,22)18-14-5-7-15(8-6-14)19-10-3-2-4-11-19/h5-8,18H,2-4,9-13H2,1H3,(H,17,20) |
| InChIKey | OLFYILNSKPLCDR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|