C20H27N5O5S — CID 75433987
methyl (2S)-3-(1H-imidazol-5-yl)-2-[[2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetyl]amino]propanoate (PubChem CID 75433987) has the molecular formula C20H27N5O5S and a molecular weight of 449.53 g/mol. Its IUPAC name is methyl (2S)-3-(1H-imidazol-5-yl)-2-[[2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-[[2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 75433987 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-[[2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CS(=O)(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H27N5O5S/c1-30-20(27)18(11-16-12-21-14-22-16)23-19(26)13-31(28,29)24-15-5-7-17(8-6-15)25-9-3-2-4-10-25/h5-8,12,14,18,24H,2-4,9-11,13H2,1H3,(H,21,22)(H,23,26)/t18-/m0/s1 |
| InChIKey | HVMJYAMZRJZRAJ-SFHVURJKSA-N |
| XLogP | 1.04 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|