C20H25N3O4S — CID 47801133
N-(4-methoxyphenyl)-2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetamide (PubChem CID 47801133) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetamide |
|---|---|
| PubChem CID | 47801133 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(4-piperidin-1-ylphenyl)sulfamoyl]acetamide |
| SMILES | COc1ccc(NC(=O)CS(=O)(=O)Nc2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-27-19-11-7-16(8-12-19)21-20(24)15-28(25,26)22-17-5-9-18(10-6-17)23-13-3-2-4-14-23/h5-12,22H,2-4,13-15H2,1H3,(H,21,24) |
| InChIKey | XKWJTQPAYGBHGG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|