C25H30N4O3S2 — CID 55694978
N-[2-(4-phenylpiperazin-1-yl)propyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide (PubChem CID 55694978) has the molecular formula C25H30N4O3S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[2-(4-phenylpiperazin-1-yl)propyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-[2-(4-phenylpiperazin-1-yl)propyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 55694978 |
| Molecular Formula | C25H30N4O3S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-[2-(4-phenylpiperazin-1-yl)propyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
| SMILES | CC(CNC(=O)Cc1ccc(NS(=O)(=O)c2cccs2)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N4O3S2/c1-20(28-13-15-29(16-14-28)23-6-3-2-4-7-23)19-26-24(30)18-21-9-11-22(12-10-21)27-34(31,32)25-8-5-17-33-25/h2-12,17,20,27H,13-16,18-19H2,1H3,(H,26,30) |
| InChIKey | NSKLHUQOZIQWMP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |