C18H23ClN3O2S+ — CID 7210705
4-chloro-N-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 7210705) has the molecular formula C18H23ClN3O2S+ and a molecular weight of 380.92 g/mol. Its IUPAC name is 4-chloro-N-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7210705 |
| Molecular Formula | C18H23ClN3O2S+ |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-chloro-N-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | C[NH+]1CCN(c2ccc(CNS(=O)(=O)c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-21-10-12-22(13-11-21)17-6-2-15(3-7-17)14-20-25(23,24)18-8-4-16(19)5-9-18/h2-9,20H,10-14H2,1H3/p+1 |
| InChIKey | ICXZDLIUAROBMP-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|