C26H26N2O4S — CID 18895585
2-[[3-[1-(2-ethyl-6-methylanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895585) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[[3-[1-(2-ethyl-6-methylanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[1-(2-ethyl-6-methylanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895585 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[[3-[1-(2-ethyl-6-methylanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCc1cccc(C)c1NC(=O)C(C)Sc1cccc(NC(=O)c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C26H26N2O4S/c1-4-18-10-7-9-16(2)23(18)28-24(29)17(3)33-20-12-8-11-19(15-20)27-25(30)21-13-5-6-14-22(21)26(31)32/h5-15,17H,4H2,1-3H3,(H,27,30)(H,28,29)(H,31,32) |
| InChIKey | NNESXGHEAAOCOB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |