C27H24Cl4N2O4S — CID 18896017
2,3,4,5-tetrachloro-6-[[3-[1-(2-ethyl-6-methylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18896017) has the molecular formula C27H24Cl4N2O4S and a molecular weight of 614.38 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[1-(2-ethyl-6-methylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[1-(2-ethyl-6-methylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18896017 |
| Molecular Formula | C27H24Cl4N2O4S |
| Molecular Weight | 614.38 g/mol |
| Exact Mass | 612.02 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[1-(2-ethyl-6-methylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCc1cccc(C)c1NC(=O)C(CC)Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1 |
| InChI | InChI=1S/C27H24Cl4N2O4S/c1-4-14-9-6-8-13(3)24(14)33-25(34)17(5-2)38-16-11-7-10-15(12-16)32-26(35)18-19(27(36)37)21(29)23(31)22(30)20(18)28/h6-12,17H,4-5H2,1-3H3,(H,32,35)(H,33,34)(H,36,37) |
| InChIKey | BTNXVXAZEAWGOA-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.38 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|