C44H30FN3O5S — CID 19320309
N-[(E)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19320309) has the molecular formula C44H30FN3O5S and a molecular weight of 731.81 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320309 |
| Molecular Formula | C44H30FN3O5S |
| Molecular Weight | 731.81 g/mol |
| Exact Mass | 731.19 |
| IUPAC Name | N-[(E)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)c2ccccc2)c1)/C(=C\c1ccccc1F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C44H30FN3O5S/c45-35-23-10-7-17-29(35)25-37(48-42(51)28-15-5-2-6-16-28)43(52)46-30-18-11-19-31(26-30)54-41(27-13-3-1-4-14-27)44(53)47-36-24-12-22-34-38(36)40(50)33-21-9-8-20-32(33)39(34)49/h1-26,41H,(H,46,52)(H,47,53)(H,48,51)/b37-25+ |
| InChIKey | RFPONNIAGKMHLE-AUGOTPMTSA-N |
| XLogP | 8.48 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.81 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|