C36H33Cl2N3O5S — CID 21385245
butyl 4-[2-[4-[[(Z)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 21385245) has the molecular formula C36H33Cl2N3O5S and a molecular weight of 690.65 g/mol. Its IUPAC name is butyl 4-[2-[4-[[(Z)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | butyl 4-[2-[4-[[(Z)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 21385245 |
| Molecular Formula | C36H33Cl2N3O5S |
| Molecular Weight | 690.65 g/mol |
| Exact Mass | 689.15 |
| IUPAC Name | butyl 4-[2-[4-[[(Z)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H33Cl2N3O5S/c1-3-4-21-46-36(45)25-13-15-26(16-14-25)39-33(42)23(2)47-28-19-17-27(18-20-28)40-35(44)32(22-29-30(37)11-8-12-31(29)38)41-34(43)24-9-6-5-7-10-24/h5-20,22-23H,3-4,21H2,1-2H3,(H,39,42)(H,40,44)(H,41,43)/b32-22- |
| InChIKey | HPYRBXNEWWJYTM-JDCMOKTRSA-N |
| XLogP | 8.48 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.65 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|