C32H27Cl2N3O4S — CID 21385216
N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[1-(2-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21385216) has the molecular formula C32H27Cl2N3O4S and a molecular weight of 620.56 g/mol. Its IUPAC name is N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[1-(2-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[1-(2-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385216 |
| Molecular Formula | C32H27Cl2N3O4S |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 619.11 |
| IUPAC Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[1-(2-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1NC(=O)C(C)Sc1ccc(NC(=O)/C(=C/c2c(Cl)cccc2Cl)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H27Cl2N3O4S/c1-20(30(38)36-27-13-6-7-14-29(27)41-2)42-23-17-15-22(16-18-23)35-32(40)28(19-24-25(33)11-8-12-26(24)34)37-31(39)21-9-4-3-5-10-21/h3-20H,1-2H3,(H,35,40)(H,36,38)(H,37,39)/b28-19- |
| InChIKey | RZXUWEPBSOWEGF-USHMODERSA-N |
| XLogP | 7.53 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|