C33H29Cl2N3O5S — CID 21385399
N-[(Z)-3-[4-[1-(2,3-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21385399) has the molecular formula C33H29Cl2N3O5S and a molecular weight of 650.58 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2,3-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2,3-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385399 |
| Molecular Formula | C33H29Cl2N3O5S |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2,3-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C)C(=O)Nc3cccc(Cl)c3Cl)cc2)c1OC |
| InChI | InChI=1S/C33H29Cl2N3O5S/c1-20(31(39)37-26-13-8-12-25(34)29(26)35)44-24-17-15-23(16-18-24)36-33(41)27(38-32(40)21-9-5-4-6-10-21)19-22-11-7-14-28(42-2)30(22)43-3/h4-20H,1-3H3,(H,36,41)(H,37,39)(H,38,40)/b27-19- |
| InChIKey | MJTKUTRQQKMBGL-DIBXZPPDSA-N |
| XLogP | 7.54 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|