C29H30N4O4S — CID 98060064
N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)acetamide (PubChem CID 98060064) has the molecular formula C29H30N4O4S and a molecular weight of 530.65 g/mol. Its IUPAC name is N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)acetamide.
| Compound Name | N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)acetamide |
|---|---|
| PubChem CID | 98060064 |
| Molecular Formula | C29H30N4O4S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)acetamide |
| SMILES | Cc1cccc(-n2c(C)cc(/C=N\NC(=O)CN(c3ccc(Oc4ccccc4)cc3)S(C)(=O)=O)c2C)c1 |
| InChI | InChI=1S/C29H30N4O4S/c1-21-9-8-10-26(17-21)33-22(2)18-24(23(33)3)19-30-31-29(34)20-32(38(4,35)36)25-13-15-28(16-14-25)37-27-11-6-5-7-12-27/h5-19H,20H2,1-4H3,(H,31,34)/b30-19- |
| InChIKey | OMXBPBNNSVASBK-FSGOGVSDSA-N |
| XLogP | 5.11 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|