C17H14FN7O5 — CID 137051480
2-[5-(4-fluorophenyl)tetrazol-2-yl]-N-[(Z)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]acetamide (PubChem CID 137051480) has the molecular formula C17H14FN7O5 and a molecular weight of 415.34 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)tetrazol-2-yl]-N-[(Z)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[5-(4-fluorophenyl)tetrazol-2-yl]-N-[(Z)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137051480 |
| Molecular Formula | C17H14FN7O5 |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[5-(4-fluorophenyl)tetrazol-2-yl]-N-[(Z)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1c(O)ccc(/C=N\NC(=O)Cn2nnc(-c3ccc(F)cc3)n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14FN7O5/c1-30-16-13(26)7-4-11(15(16)25(28)29)8-19-20-14(27)9-24-22-17(21-23-24)10-2-5-12(18)6-3-10/h2-8,26H,9H2,1H3,(H,20,27)/b19-8- |
| InChIKey | FILRYLJGALHLFV-UWVJOHFNSA-N |
| XLogP | 1.25 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|