C29H27N3O4 — CID 3833210
[4-[[[2-(2,6-dimethylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] naphthalene-1-carboxylate (PubChem CID 3833210) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is [4-[[[2-(2,6-dimethylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[[[2-(2,6-dimethylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 3833210 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | [4-[[[2-(2,6-dimethylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] naphthalene-1-carboxylate |
| SMILES | COc1cc(C=NNC(=O)CNc2c(C)cccc2C)ccc1OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H27N3O4/c1-19-8-6-9-20(2)28(19)30-18-27(33)32-31-17-21-14-15-25(26(16-21)35-3)36-29(34)24-13-7-11-22-10-4-5-12-23(22)24/h4-17,30H,18H2,1-3H3,(H,32,33) |
| InChIKey | OGSKXHGPRHVYMO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|