C20H17N3O3S — CID 1208795
[5-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] naphthalene-1-carboxylate (PubChem CID 1208795) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is [5-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] naphthalene-1-carboxylate.
| Compound Name | [5-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 1208795 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [5-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] naphthalene-1-carboxylate |
| SMILES | COc1ccc(C=NNC(N)=S)cc1OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H17N3O3S/c1-25-17-10-9-13(12-22-23-20(21)27)11-18(17)26-19(24)16-8-4-6-14-5-2-3-7-15(14)16/h2-12H,1H3,(H3,21,23,27) |
| InChIKey | PYAMNADAQIAPDC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|