C16H12ClF2N3O3S — CID 5341347
[4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 5341347) has the molecular formula C16H12ClF2N3O3S and a molecular weight of 399.81 g/mol. Its IUPAC name is [4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 5341347 |
| Molecular Formula | C16H12ClF2N3O3S |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | [4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | COc1cc(/C=N\NC(N)=S)ccc1OC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H12ClF2N3O3S/c1-24-14-4-8(7-21-22-16(20)26)2-3-13(14)25-15(23)9-5-11(18)12(19)6-10(9)17/h2-7H,1H3,(H3,20,22,26)/b21-7- |
| InChIKey | GBBFUIARSXOBGN-YXSASFKJSA-N |
| XLogP | 3.01 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|