C16H11ClF2N6O3 — CID 6065646
[2-methoxy-4-[(Z)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 6065646) has the molecular formula C16H11ClF2N6O3 and a molecular weight of 408.75 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-methoxy-4-[(Z)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 6065646 |
| Molecular Formula | C16H11ClF2N6O3 |
| Molecular Weight | 408.75 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [2-methoxy-4-[(Z)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | COc1cc(/C=N\Nc2nn[nH]n2)ccc1OC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H11ClF2N6O3/c1-27-14-4-8(7-20-21-16-22-24-25-23-16)2-3-13(14)28-15(26)9-5-11(18)12(19)6-10(9)17/h2-7H,1H3,(H2,21,22,23,24,25)/b20-7- |
| InChIKey | JAMCRZRCLOCYEC-SCDVKCJHSA-N |
| XLogP | 2.81 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|