C21H17Cl2N3O5S — CID 71967135
methyl 2-[2-[[4-(2,4-dichlorobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 71967135) has the molecular formula C21H17Cl2N3O5S and a molecular weight of 494.36 g/mol. Its IUPAC name is methyl 2-[2-[[4-(2,4-dichlorobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[2-[[4-(2,4-dichlorobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 71967135 |
| Molecular Formula | C21H17Cl2N3O5S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | methyl 2-[2-[[4-(2,4-dichlorobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NN=Cc2ccc(OC(=O)c3ccc(Cl)cc3Cl)c(OC)c2)nc1C |
| InChI | InChI=1S/C21H17Cl2N3O5S/c1-11-18(20(28)30-3)32-21(25-11)26-24-10-12-4-7-16(17(8-12)29-2)31-19(27)14-6-5-13(22)9-15(14)23/h4-10H,1-3H3,(H,25,26) |
| InChIKey | PIGFNQVACSZRJM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|