C29H23Cl2N3O3S2 — CID 22188729
N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22188729) has the molecular formula C29H23Cl2N3O3S2 and a molecular weight of 596.56 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188729 |
| Molecular Formula | C29H23Cl2N3O3S2 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 595.06 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C29H23Cl2N3O3S2/c1-18(27(35)33-25-16-21(30)7-12-24(25)31)39-23-10-8-22(9-11-23)32-29(37)26(15-19-13-14-38-17-19)34-28(36)20-5-3-2-4-6-20/h2-18H,1H3,(H,32,37)(H,33,35)(H,34,36)/b26-15- |
| InChIKey | WQBMQSZBKUGFLS-YSMPRRRNSA-N |
| XLogP | 7.58 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|